About 3-(3,3-dimethylmorpholin-4-yl)propane-1-sulfonyl chloride
3-(3,3-dimethylmorpholin-4-yl)propane-1-sulfonyl chloride (PubChem CID 112594686) has the molecular formula C9H18ClNO3S
and a molecular weight of 255.77 g/mol. Its IUPAC name is 3-(3,3-dimethylmorpholin-4-yl)propane-1-sulfonyl chloride.
Analyze 3-(3,3-dimethylmorpholin-4-yl)propane-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethylmorpholin-4-yl)propane-1-sulfonyl chloride?
The IUPAC name of 3-(3,3-dimethylmorpholin-4-yl)propane-1-sulfonyl chloride (CID 112594686) is 3-(3,3-dimethylmorpholin-4-yl)propane-1-sulfonyl chloride.
What is the SMILES notation for 3-(3,3-dimethylmorpholin-4-yl)propane-1-sulfonyl chloride?
The canonical SMILES for 3-(3,3-dimethylmorpholin-4-yl)propane-1-sulfonyl chloride is CC1(C)COCCN1CCCS(=O)(=O)Cl.
What is the InChIKey of 3-(3,3-dimethylmorpholin-4-yl)propane-1-sulfonyl chloride?
The InChIKey is VVXVBYDEZJROMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18ClNO3S/c1-9(2)8-14-6-5-11(9)4-3-7-15(10,12)13/h3-8H2,1-2H3.
What are the key properties of 3-(3,3-dimethylmorpholin-4-yl)propane-1-sulfonyl chloride?
3-(3,3-dimethylmorpholin-4-yl)propane-1-sulfonyl chloride has a molecular weight of 255.77 g/mol, XLogP of 1.06, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethylmorpholin-4-yl)propane-1-sulfonyl chloride is sourced from PubChem (CID 112594686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).