C13H22N2O — CID 145197774
2-[(3,3-dimethylmorpholin-4-yl)methyl]-N-prop-1-en-2-ylprop-2-en-1-imine (PubChem CID 145197774) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N-prop-1-en-2-ylprop-2-en-1-imine.
| Compound Name | 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N-prop-1-en-2-ylprop-2-en-1-imine |
|---|---|
| PubChem CID | 145197774 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-[(3,3-dimethylmorpholin-4-yl)methyl]-N-prop-1-en-2-ylprop-2-en-1-imine |
| SMILES | C=C(/C=N/C(=C)C)CN1CCOCC1(C)C |
| InChI | InChI=1S/C13H22N2O/c1-11(2)14-8-12(3)9-15-6-7-16-10-13(15,4)5/h8H,1,3,6-7,9-10H2,2,4-5H3/b14-8+ |
| InChIKey | PNPGSEOZPNQOJZ-RIYZIHGNSA-N |
| XLogP | 2.26 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|