C30H51N3O4 — CID 172936189
7,7-dimethyl-1-(2-morpholin-4-ylethyl)bicyclo[2.2.1]heptan-2-one;(NZ)-N-[7,7-dimethyl-1-(2-morpholin-4-ylethyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 172936189) has the molecular formula C30H51N3O4 and a molecular weight of 517.76 g/mol. Its IUPAC name is 7,7-dimethyl-1-(2-morpholin-4-ylethyl)bicyclo[2.2.1]heptan-2-one;(NZ)-N-[7,7-dimethyl-1-(2-morpholin-4-ylethyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | 7,7-dimethyl-1-(2-morpholin-4-ylethyl)bicyclo[2.2.1]heptan-2-one;(NZ)-N-[7,7-dimethyl-1-(2-morpholin-4-ylethyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 172936189 |
| Molecular Formula | C30H51N3O4 |
| Molecular Weight | 517.76 g/mol |
| Exact Mass | 517.39 |
| IUPAC Name | 7,7-dimethyl-1-(2-morpholin-4-ylethyl)bicyclo[2.2.1]heptan-2-one;(NZ)-N-[7,7-dimethyl-1-(2-morpholin-4-ylethyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | CC1(C)C2CCC1(CCN1CCOCC1)/C(=N\O)C2.CC1(C)C2CCC1(CCN1CCOCC1)C(=O)C2 |
| InChI | InChI=1S/C15H26N2O2.C15H25NO2/c1-14(2)12-3-4-15(14,13(11-12)16-18)5-6-17-7-9-19-10-8-17;1-14(2)12-3-4-15(14,13(17)11-12)5-6-16-7-9-18-10-8-16/h12,18H,3-11H2,1-2H3;12H,3-11H2,1-2H3/b16-13-; |
| InChIKey | QTLXZZDEBSNXHV-UNVLYCKESA-N |
| XLogP | 4.47 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.76 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|