C16H25N3O4 — CID 98551589
(4E,4aR,4bS,8aS)-4-hydroxyimino-8a-morpholin-4-yl-9-oxido-1,2,3,4b,5,6,7,8-octahydrocarbazol-9-ium-4a-ol (PubChem CID 98551589) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is (4E,4aR,4bS,8aS)-4-hydroxyimino-8a-morpholin-4-yl-9-oxido-1,2,3,4b,5,6,7,8-octahydrocarbazol-9-ium-4a-ol.
| Compound Name | (4E,4aR,4bS,8aS)-4-hydroxyimino-8a-morpholin-4-yl-9-oxido-1,2,3,4b,5,6,7,8-octahydrocarbazol-9-ium-4a-ol |
|---|---|
| PubChem CID | 98551589 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | (4E,4aR,4bS,8aS)-4-hydroxyimino-8a-morpholin-4-yl-9-oxido-1,2,3,4b,5,6,7,8-octahydrocarbazol-9-ium-4a-ol |
| SMILES | [O-][N+]1=C2CCC/C(=N\O)[C@]2(O)[C@H]2CCCC[C@@]21N1CCOCC1 |
| InChI | InChI=1S/C16H25N3O4/c20-16-12-4-1-2-7-15(12,18-8-10-23-11-9-18)19(22)14(16)6-3-5-13(16)17-21/h12,20-21H,1-11H2/b17-13+/t12-,15-,16+/m0/s1 |
| InChIKey | RVDDMZVJRQNLED-LSXABQRPSA-N |
| XLogP | 0.92 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|