C19H26N2O3 — CID 608934
3-methyl-3-morpholin-4-yl-1-oxido-4-phenyl-4,4a,5,6,7,8-hexahydro-2,1-benzoxazin-1-ium (PubChem CID 608934) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-methyl-3-morpholin-4-yl-1-oxido-4-phenyl-4,4a,5,6,7,8-hexahydro-2,1-benzoxazin-1-ium.
| Compound Name | 3-methyl-3-morpholin-4-yl-1-oxido-4-phenyl-4,4a,5,6,7,8-hexahydro-2,1-benzoxazin-1-ium |
|---|---|
| PubChem CID | 608934 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 3-methyl-3-morpholin-4-yl-1-oxido-4-phenyl-4,4a,5,6,7,8-hexahydro-2,1-benzoxazin-1-ium |
| SMILES | CC1(N2CCOCC2)O[N+]([O-])=C2CCCCC2C1c1ccccc1 |
| InChI | InChI=1S/C19H26N2O3/c1-19(20-11-13-23-14-12-20)18(15-7-3-2-4-8-15)16-9-5-6-10-17(16)21(22)24-19/h2-4,7-8,16,18H,5-6,9-14H2,1H3 |
| InChIKey | XEYRKNHKNBEESG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |