C19H26N2O4 — CID 51032703
(3R,3aR)-3-(3-nitrophenyl)-1-oxido-3,3a,4,5,6,7,8,9,10,11,12,13-dodecahydrocyclododeca[c][1,2]oxazol-1-ium (PubChem CID 51032703) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is (3R,3aR)-3-(3-nitrophenyl)-1-oxido-3,3a,4,5,6,7,8,9,10,11,12,13-dodecahydrocyclododeca[c][1,2]oxazol-1-ium.
| Compound Name | (3R,3aR)-3-(3-nitrophenyl)-1-oxido-3,3a,4,5,6,7,8,9,10,11,12,13-dodecahydrocyclododeca[c][1,2]oxazol-1-ium |
|---|---|
| PubChem CID | 51032703 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (3R,3aR)-3-(3-nitrophenyl)-1-oxido-3,3a,4,5,6,7,8,9,10,11,12,13-dodecahydrocyclododeca[c][1,2]oxazol-1-ium |
| SMILES | O=[N+]([O-])c1cccc([C@@H]2O[N+]([O-])=C3CCCCCCCCCC[C@H]32)c1 |
| InChI | InChI=1S/C19H26N2O4/c22-20(23)16-11-9-10-15(14-16)19-17-12-7-5-3-1-2-4-6-8-13-18(17)21(24)25-19/h9-11,14,17,19H,1-8,12-13H2/t17-,19+/m1/s1 |
| InChIKey | ZCTLMFHAGWBYPF-MJGOQNOKSA-N |
| XLogP | 5.06 |
| TPSA | 78.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|