C24H30N2O — CID 67037319
4-[(6R,9S)-6,9-diphenyl-3-azabicyclo[3.2.2]nonan-1-yl]morpholine (PubChem CID 67037319) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 4-[(6R,9S)-6,9-diphenyl-3-azabicyclo[3.2.2]nonan-1-yl]morpholine.
| Compound Name | 4-[(6R,9S)-6,9-diphenyl-3-azabicyclo[3.2.2]nonan-1-yl]morpholine |
|---|---|
| PubChem CID | 67037319 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 4-[(6R,9S)-6,9-diphenyl-3-azabicyclo[3.2.2]nonan-1-yl]morpholine |
| SMILES | c1ccc([C@H]2CC3(N4CCOCC4)CNCC2[C@H](c2ccccc2)C3)cc1 |
| InChI | InChI=1S/C24H30N2O/c1-3-7-19(8-4-1)21-15-24(26-11-13-27-14-12-26)16-22(23(21)17-25-18-24)20-9-5-2-6-10-20/h1-10,21-23,25H,11-18H2/t21-,22+,23?,24? |
| InChIKey | QDRFBNUPHMXBIU-KFGJODCASA-N |
| XLogP | 3.64 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |