C15H20N4O5 — CID 4548606
11-morpholin-4-yl-5,10-dioxido-4-oxa-3-aza-5,10-diazoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-1-ol (PubChem CID 4548606) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is 11-morpholin-4-yl-5,10-dioxido-4-oxa-3-aza-5,10-diazoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-1-ol.
| Compound Name | 11-morpholin-4-yl-5,10-dioxido-4-oxa-3-aza-5,10-diazoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-1-ol |
|---|---|
| PubChem CID | 4548606 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 11-morpholin-4-yl-5,10-dioxido-4-oxa-3-aza-5,10-diazoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-1-ol |
| SMILES | [O-][N+]1=C2CCc3c(no[n+]3[O-])C2(O)C2CCCC21N1CCOCC1 |
| InChI | InChI=1S/C15H20N4O5/c20-15-11-2-1-5-14(11,17-6-8-23-9-7-17)18(21)12(15)4-3-10-13(15)16-24-19(10)22/h11,20H,1-9H2 |
| InChIKey | BCHAWVBICZFBNU-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 111.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|