C14H21N6O3+ — CID 7391535
furan-2-yl-[4-[[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperazin-4-ium-1-yl]methanone (PubChem CID 7391535) has the molecular formula C14H21N6O3+ and a molecular weight of 321.36 g/mol. Its IUPAC name is furan-2-yl-[4-[[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperazin-4-ium-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 7391535 |
| Molecular Formula | C14H21N6O3+ |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | furan-2-yl-[4-[[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperazin-4-ium-1-yl]methanone |
| SMILES | COCCn1nnnc1C[NH+]1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C14H20N6O3/c1-22-10-8-20-13(15-16-17-20)11-18-4-6-19(7-5-18)14(21)12-3-2-9-23-12/h2-3,9H,4-8,10-11H2,1H3/p+1 |
| InChIKey | IUOPQKOOBAVZQA-UHFFFAOYSA-O |
| XLogP | -1.55 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |