C18H12Cl2O5 — CID 7392525
(5R)-5-(2,4-dichlorophenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]oxolane-2,3-dione (PubChem CID 7392525) has the molecular formula C18H12Cl2O5 and a molecular weight of 379.20 g/mol. Its IUPAC name is (5R)-5-(2,4-dichlorophenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]oxolane-2,3-dione.
| Compound Name | (5R)-5-(2,4-dichlorophenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]oxolane-2,3-dione |
|---|---|
| PubChem CID | 7392525 |
| Molecular Formula | C18H12Cl2O5 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | (5R)-5-(2,4-dichlorophenyl)-4-[hydroxy-(4-methoxyphenyl)methylidene]oxolane-2,3-dione |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)O[C@H]2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H12Cl2O5/c1-24-11-5-2-9(3-6-11)15(21)14-16(22)18(23)25-17(14)12-7-4-10(19)8-13(12)20/h2-8,17,21H,1H3/t17-/m0/s1 |
| InChIKey | REAKDHYMGAXTAG-KRWDZBQOSA-N |
| XLogP | 4.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|