C18H11N2O4S- — CID 7393505
2-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 7393505) has the molecular formula C18H11N2O4S- and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7393505 |
| Molecular Formula | C18H11N2O4S- |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | N#Cc1c(N2C(=O)c3ccc(C(=O)[O-])cc3C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C18H12N2O4S/c19-8-13-10-3-1-2-4-14(10)25-17(13)20-15(21)11-6-5-9(18(23)24)7-12(11)16(20)22/h5-7H,1-4H2,(H,23,24)/p-1 |
| InChIKey | QABAZYPYDHIBNA-UHFFFAOYSA-M |
| XLogP | 1.66 |
| TPSA | 101.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|