C16H11N3O2S — CID 130609897
2-(1,3-dioxoisoindol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile (PubChem CID 130609897) has the molecular formula C16H11N3O2S and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 130609897 |
| Molecular Formula | C16H11N3O2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(N2C(=O)c3ccccc3C2=O)sc2c1CCNC2 |
| InChI | InChI=1S/C16H11N3O2S/c17-7-12-9-5-6-18-8-13(9)22-16(12)19-14(20)10-3-1-2-4-11(10)15(19)21/h1-4,18H,5-6,8H2 |
| InChIKey | LPAGSDBGDGNZHG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|