C10H9N5OS — CID 107410832
2-(5-oxo-1H-1,2,4-triazol-4-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile (PubChem CID 107410832) has the molecular formula C10H9N5OS and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-(5-oxo-1H-1,2,4-triazol-4-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile.
| Compound Name | 2-(5-oxo-1H-1,2,4-triazol-4-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 107410832 |
| Molecular Formula | C10H9N5OS |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-(5-oxo-1H-1,2,4-triazol-4-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-n2cn[nH]c2=O)sc2c1CCNC2 |
| InChI | InChI=1S/C10H9N5OS/c11-3-7-6-1-2-12-4-8(6)17-9(7)15-5-13-14-10(15)16/h5,12H,1-2,4H2,(H,14,16) |
| InChIKey | GOTVAEWXLDMHKU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |