C15H16Cl2NO+ — CID 7394464
(3,4-dichlorophenyl)methyl-[(2R)-2-hydroxy-2-phenylethyl]azanium (PubChem CID 7394464) has the molecular formula C15H16Cl2NO+ and a molecular weight of 297.21 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl-[(2R)-2-hydroxy-2-phenylethyl]azanium.
| Compound Name | (3,4-dichlorophenyl)methyl-[(2R)-2-hydroxy-2-phenylethyl]azanium |
|---|---|
| PubChem CID | 7394464 |
| Molecular Formula | C15H16Cl2NO+ |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | (3,4-dichlorophenyl)methyl-[(2R)-2-hydroxy-2-phenylethyl]azanium |
| SMILES | O[C@@H](C[NH2+]Cc1ccc(Cl)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C15H15Cl2NO/c16-13-7-6-11(8-14(13)17)9-18-10-15(19)12-4-2-1-3-5-12/h1-8,15,18-19H,9-10H2/p+1/t15-/m0/s1 |
| InChIKey | WQSDSDPSYHICRT-HNNXBMFYSA-O |
| XLogP | 2.79 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |