C21H20Cl2NO+ — CID 7091495
(3,4-dichlorophenyl)methyl-(2-hydroxy-2,2-diphenylethyl)azanium (PubChem CID 7091495) has the molecular formula C21H20Cl2NO+ and a molecular weight of 373.30 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl-(2-hydroxy-2,2-diphenylethyl)azanium.
| Compound Name | (3,4-dichlorophenyl)methyl-(2-hydroxy-2,2-diphenylethyl)azanium |
|---|---|
| PubChem CID | 7091495 |
| Molecular Formula | C21H20Cl2NO+ |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (3,4-dichlorophenyl)methyl-(2-hydroxy-2,2-diphenylethyl)azanium |
| SMILES | OC(C[NH2+]Cc1ccc(Cl)c(Cl)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19Cl2NO/c22-19-12-11-16(13-20(19)23)14-24-15-21(25,17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-13,24-25H,14-15H2/p+1 |
| InChIKey | QSRJFDLGXIEFAD-UHFFFAOYSA-O |
| XLogP | 3.99 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |