C20H21N2O4S+ — CID 7400633
ethyl (1R,3R,3aS,6aS)-5-methyl-4,6-dioxo-3-phenyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate (PubChem CID 7400633) has the molecular formula C20H21N2O4S+ and a molecular weight of 385.47 g/mol. Its IUPAC name is ethyl (1R,3R,3aS,6aS)-5-methyl-4,6-dioxo-3-phenyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate.
| Compound Name | ethyl (1R,3R,3aS,6aS)-5-methyl-4,6-dioxo-3-phenyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 7400633 |
| Molecular Formula | C20H21N2O4S+ |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | ethyl (1R,3R,3aS,6aS)-5-methyl-4,6-dioxo-3-phenyl-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(c2ccccc2)[NH2+][C@@H](c2cccs2)[C@H]2C(=O)N(C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C20H20N2O4S/c1-3-26-19(25)20(12-8-5-4-6-9-12)15-14(17(23)22(2)18(15)24)16(21-20)13-10-7-11-27-13/h4-11,14-16,21H,3H2,1-2H3/p+1/t14-,15+,16-,20-/m0/s1 |
| InChIKey | GFAUSLZKBQHEAN-QOIOWGMHSA-O |
| XLogP | 1.06 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|