C21H23N2O5S+ — CID 7404184
ethyl (1R,3S,3aS,6aS)-5-(3-methoxyphenyl)-3-methyl-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate (PubChem CID 7404184) has the molecular formula C21H23N2O5S+ and a molecular weight of 415.49 g/mol. Its IUPAC name is ethyl (1R,3S,3aS,6aS)-5-(3-methoxyphenyl)-3-methyl-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate.
| Compound Name | ethyl (1R,3S,3aS,6aS)-5-(3-methoxyphenyl)-3-methyl-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 7404184 |
| Molecular Formula | C21H23N2O5S+ |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | ethyl (1R,3S,3aS,6aS)-5-(3-methoxyphenyl)-3-methyl-4,6-dioxo-1-thiophen-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)[NH2+][C@@H](c2cccs2)[C@H]2C(=O)N(c3cccc(OC)c3)C(=O)[C@@H]21 |
| InChI | InChI=1S/C21H22N2O5S/c1-4-28-20(26)21(2)16-15(17(22-21)14-9-6-10-29-14)18(24)23(19(16)25)12-7-5-8-13(11-12)27-3/h5-11,15-17,22H,4H2,1-3H3/p+1/t15-,16+,17-,21-/m0/s1 |
| InChIKey | LTPNJGCWDGTTOP-DLRJPAPCSA-O |
| XLogP | 1.50 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|