C32H36O2 — CID 74006938
2-(3-methylpentan-3-yl)-4-[3-(3-methylpentan-3-yl)-4-oxonaphthalen-1-ylidene]naphthalen-1-one (PubChem CID 74006938) has the molecular formula C32H36O2 and a molecular weight of 452.64 g/mol. Its IUPAC name is 2-(3-methylpentan-3-yl)-4-[3-(3-methylpentan-3-yl)-4-oxonaphthalen-1-ylidene]naphthalen-1-one.
| Compound Name | 2-(3-methylpentan-3-yl)-4-[3-(3-methylpentan-3-yl)-4-oxonaphthalen-1-ylidene]naphthalen-1-one |
|---|---|
| PubChem CID | 74006938 |
| Molecular Formula | C32H36O2 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 2-(3-methylpentan-3-yl)-4-[3-(3-methylpentan-3-yl)-4-oxonaphthalen-1-ylidene]naphthalen-1-one |
| SMILES | CCC(C)(CC)C1=CC(=C2C=C(C(C)(CC)CC)C(=O)c3ccccc32)c2ccccc2C1=O |
| InChI | InChI=1S/C32H36O2/c1-7-31(5,8-2)27-19-25(21-15-11-13-17-23(21)29(27)33)26-20-28(32(6,9-3)10-4)30(34)24-18-14-12-16-22(24)26/h11-20H,7-10H2,1-6H3 |
| InChIKey | KCEOCXVSKHRIOW-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|