C29H15N2O4+ — CID 74015195
2-methyl-17-aza-2-azoniaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1,3(16),4(13),6,8,10,14,17,19(28),21,23,25,29-tridecaene-5,12,20,27-tetrone (PubChem CID 74015195) has the molecular formula C29H15N2O4+ and a molecular weight of 455.45 g/mol. Its IUPAC name is 2-methyl-17-aza-2-azoniaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1,3(16),4(13),6,8,10,14,17,19(28),21,23,25,29-tridecaene-5,12,20,27-tetrone.
| Compound Name | 2-methyl-17-aza-2-azoniaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1,3(16),4(13),6,8,10,14,17,19(28),21,23,25,29-tridecaene-5,12,20,27-tetrone |
|---|---|
| PubChem CID | 74015195 |
| Molecular Formula | C29H15N2O4+ |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 2-methyl-17-aza-2-azoniaheptacyclo[16.12.0.03,16.04,13.06,11.019,28.021,26]triaconta-1,3(16),4(13),6,8,10,14,17,19(28),21,23,25,29-tridecaene-5,12,20,27-tetrone |
| SMILES | C[n+]1c2ccc3c(=O)c4ccccc4c(=O)c3c2nc2ccc3c(=O)c4ccccc4c(=O)c3c21 |
| InChI | InChI=1S/C29H15N2O4/c1-31-21-13-11-18-22(28(34)16-8-4-2-6-14(16)26(18)32)24(21)30-20-12-10-19-23(25(20)31)29(35)17-9-5-3-7-15(17)27(19)33/h2-13H,1H3/q+1 |
| InChIKey | ZBMQDRUNUGHZOU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 85.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|