C22H22N2O5 — CID 74019988
methyl 2-[3-[3-[1,6-dimethyl-2-oxo-4-(prop-2-ynylamino)-3-pyridinyl]-3-oxoprop-1-enyl]phenoxy]acetate (PubChem CID 74019988) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is methyl 2-[3-[3-[1,6-dimethyl-2-oxo-4-(prop-2-ynylamino)-3-pyridinyl]-3-oxoprop-1-enyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[3-[1,6-dimethyl-2-oxo-4-(prop-2-ynylamino)-3-pyridinyl]-3-oxoprop-1-enyl]phenoxy]acetate |
|---|---|
| PubChem CID | 74019988 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | methyl 2-[3-[3-[1,6-dimethyl-2-oxo-4-(prop-2-ynylamino)-3-pyridinyl]-3-oxoprop-1-enyl]phenoxy]acetate |
| SMILES | C#CCNc1cc(C)n(C)c(=O)c1C(=O)C=Cc1cccc(OCC(=O)OC)c1 |
| InChI | InChI=1S/C22H22N2O5/c1-5-11-23-18-12-15(2)24(3)22(27)21(18)19(25)10-9-16-7-6-8-17(13-16)29-14-20(26)28-4/h1,6-10,12-13,23H,11,14H2,2-4H3 |
| InChIKey | WZZUERPKEJPBJO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|