C17H16N2O5 — CID 135555991
2-[3-[(E)-3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-oxoprop-1-enyl]phenoxy]acetamide (PubChem CID 135555991) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is 2-[3-[(E)-3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-oxoprop-1-enyl]phenoxy]acetamide.
| Compound Name | 2-[3-[(E)-3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-oxoprop-1-enyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 135555991 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[3-[(E)-3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-oxoprop-1-enyl]phenoxy]acetamide |
| SMILES | Cc1cc(O)c(C(=O)/C=C/c2cccc(OCC(N)=O)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H16N2O5/c1-10-7-14(21)16(17(23)19-10)13(20)6-5-11-3-2-4-12(8-11)24-9-15(18)22/h2-8H,9H2,1H3,(H2,18,22)(H2,19,21,23)/b6-5+ |
| InChIKey | NRHMDESSCSCGQE-AATRIKPKSA-N |
| XLogP | 1.15 |
| TPSA | 122.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|