C20H14N2O4 — CID 54725032
2-[3-[(E)-3-(4-hydroxy-2-oxo-1H-quinolin-3-yl)-3-oxoprop-1-enyl]phenoxy]acetonitrile (PubChem CID 54725032) has the molecular formula C20H14N2O4 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-[3-[(E)-3-(4-hydroxy-2-oxo-1H-quinolin-3-yl)-3-oxoprop-1-enyl]phenoxy]acetonitrile.
| Compound Name | 2-[3-[(E)-3-(4-hydroxy-2-oxo-1H-quinolin-3-yl)-3-oxoprop-1-enyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 54725032 |
| Molecular Formula | C20H14N2O4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[3-[(E)-3-(4-hydroxy-2-oxo-1H-quinolin-3-yl)-3-oxoprop-1-enyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1cccc(/C=C/C(=O)c2c(O)c3ccccc3[nH]c2=O)c1 |
| InChI | InChI=1S/C20H14N2O4/c21-10-11-26-14-5-3-4-13(12-14)8-9-17(23)18-19(24)15-6-1-2-7-16(15)22-20(18)25/h1-9,12H,11H2,(H2,22,24,25)/b9-8+ |
| InChIKey | SEIPQSSFQLKUOB-CMDGGOBGSA-N |
| XLogP | 3.03 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|