C20H14N2O4 — CID 58710107
4-hydroxy-3-[(E)-3-[4-(isocyanomethoxy)phenyl]prop-2-enoyl]-1H-quinolin-2-one (PubChem CID 58710107) has the molecular formula C20H14N2O4 and a molecular weight of 346.34 g/mol. Its IUPAC name is 4-hydroxy-3-[(E)-3-[4-(isocyanomethoxy)phenyl]prop-2-enoyl]-1H-quinolin-2-one.
| Compound Name | 4-hydroxy-3-[(E)-3-[4-(isocyanomethoxy)phenyl]prop-2-enoyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 58710107 |
| Molecular Formula | C20H14N2O4 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-hydroxy-3-[(E)-3-[4-(isocyanomethoxy)phenyl]prop-2-enoyl]-1H-quinolin-2-one |
| SMILES | [C-]#[N+]COc1ccc(/C=C/C(=O)c2c(O)c3ccccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C20H14N2O4/c1-21-12-26-14-9-6-13(7-10-14)8-11-17(23)18-19(24)15-4-2-3-5-16(15)22-20(18)25/h2-11H,12H2,(H2,22,24,25)/b11-8+ |
| InChIKey | ZRTXAUINQZIGGB-DHZHZOJOSA-N |
| XLogP | 3.39 |
| TPSA | 83.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|