C20H18N2O8 — CID 135555974
2-[[3-[(E)-3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-oxoprop-1-enyl]benzoyl]amino]butanedioic acid (PubChem CID 135555974) has the molecular formula C20H18N2O8 and a molecular weight of 414.37 g/mol. Its IUPAC name is 2-[[3-[(E)-3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-oxoprop-1-enyl]benzoyl]amino]butanedioic acid.
| Compound Name | 2-[[3-[(E)-3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-oxoprop-1-enyl]benzoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 135555974 |
| Molecular Formula | C20H18N2O8 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2-[[3-[(E)-3-(4-hydroxy-6-methyl-2-oxo-1H-pyridin-3-yl)-3-oxoprop-1-enyl]benzoyl]amino]butanedioic acid |
| SMILES | Cc1cc(O)c(C(=O)/C=C/c2cccc(C(=O)NC(CC(=O)O)C(=O)O)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C20H18N2O8/c1-10-7-15(24)17(19(28)21-10)14(23)6-5-11-3-2-4-12(8-11)18(27)22-13(20(29)30)9-16(25)26/h2-8,13H,9H2,1H3,(H,22,27)(H,25,26)(H,29,30)(H2,21,24,28)/b6-5+ |
| InChIKey | MQDRFTUPZCKRTR-AATRIKPKSA-N |
| XLogP | 0.94 |
| TPSA | 173.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|