C17H19NO6 — CID 74020640
methyl 2-[3,5-dihydroxy-2-[5-(3-hydroxyiminobutyl)furan-2-yl]phenyl]acetate (PubChem CID 74020640) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is methyl 2-[3,5-dihydroxy-2-[5-(3-hydroxyiminobutyl)furan-2-yl]phenyl]acetate.
| Compound Name | methyl 2-[3,5-dihydroxy-2-[5-(3-hydroxyiminobutyl)furan-2-yl]phenyl]acetate |
|---|---|
| PubChem CID | 74020640 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | methyl 2-[3,5-dihydroxy-2-[5-(3-hydroxyiminobutyl)furan-2-yl]phenyl]acetate |
| SMILES | COC(=O)Cc1cc(O)cc(O)c1-c1ccc(CCC(C)=NO)o1 |
| InChI | InChI=1S/C17H19NO6/c1-10(18-22)3-4-13-5-6-15(24-13)17-11(8-16(21)23-2)7-12(19)9-14(17)20/h5-7,9,19-20,22H,3-4,8H2,1-2H3 |
| InChIKey | UUZIQDZTSYYREM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|