About 4-nitrobenzenesulfonyl chloride
4-nitrobenzenesulfonyl chloride (PubChem CID 7404) has the molecular formula C6H4ClNO4S
and a molecular weight of 221.62 g/mol. Its IUPAC name is 4-nitrobenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 4-nitrobenzenesulfonyl chloride |
| PubChem CID | 7404 |
| Molecular Formula | C6H4ClNO4S |
| Molecular Weight | 221.62 g/mol |
| Exact Mass | 220.95 |
| IUPAC Name | 4-nitrobenzenesulfonyl chloride |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Cl)cc1 |
| InChI | InChI=1S/C6H4ClNO4S/c7-13(11,12)6-3-1-5(2-4-6)8(9)10/h1-4H |
| InChIKey | JXRGUPLJCCDGKG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.62 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitrobenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitrobenzenesulfonyl chloride?
The IUPAC name of 4-nitrobenzenesulfonyl chloride (CID 7404) is 4-nitrobenzenesulfonyl chloride.
What is the SMILES notation for 4-nitrobenzenesulfonyl chloride?
The canonical SMILES for 4-nitrobenzenesulfonyl chloride is O=[N+]([O-])c1ccc(S(=O)(=O)Cl)cc1.
What is the InChIKey of 4-nitrobenzenesulfonyl chloride?
The InChIKey is JXRGUPLJCCDGKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClNO4S/c7-13(11,12)6-3-1-5(2-4-6)8(9)10/h1-4H.
What are the key properties of 4-nitrobenzenesulfonyl chloride?
4-nitrobenzenesulfonyl chloride has a molecular weight of 221.62 g/mol, XLogP of 1.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitrobenzenesulfonyl chloride is sourced from PubChem (CID 7404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).