About 2,4-dinitrobenzenesulfonic acid
2,4-dinitrobenzenesulfonic acid (PubChem CID 6959) has the molecular formula C6H4N2O7S
and a molecular weight of 248.17 g/mol. Its IUPAC name is 2,4-dinitrobenzenesulfonic acid.
Molecular Properties
| Compound Name | 2,4-dinitrobenzenesulfonic acid |
| PubChem CID | 6959 |
| Molecular Formula | C6H4N2O7S |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | 2,4-dinitrobenzenesulfonic acid |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H4N2O7S/c9-7(10)4-1-2-6(16(13,14)15)5(3-4)8(11)12/h1-3H,(H,13,14,15) |
| InChIKey | OVOJUAKDTOOXRF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dinitrobenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dinitrobenzenesulfonic acid?
The IUPAC name of 2,4-dinitrobenzenesulfonic acid (CID 6959) is 2,4-dinitrobenzenesulfonic acid.
What is the SMILES notation for 2,4-dinitrobenzenesulfonic acid?
The canonical SMILES for 2,4-dinitrobenzenesulfonic acid is O=[N+]([O-])c1ccc(S(=O)(=O)O)c([N+](=O)[O-])c1.
What is the InChIKey of 2,4-dinitrobenzenesulfonic acid?
The InChIKey is OVOJUAKDTOOXRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O7S/c9-7(10)4-1-2-6(16(13,14)15)5(3-4)8(11)12/h1-3H,(H,13,14,15).
What are the key properties of 2,4-dinitrobenzenesulfonic acid?
2,4-dinitrobenzenesulfonic acid has a molecular weight of 248.17 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dinitrobenzenesulfonic acid is sourced from PubChem (CID 6959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).