C20H21NO4 — CID 7404577
2-(3-methylphenoxy)ethyl 4-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 7404577) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-(3-methylphenoxy)ethyl 4-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | 2-(3-methylphenoxy)ethyl 4-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 7404577 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-(3-methylphenoxy)ethyl 4-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | Cc1cccc(OCCOC(=O)c2ccc(N3CCCC3=O)cc2)c1 |
| InChI | InChI=1S/C20H21NO4/c1-15-4-2-5-18(14-15)24-12-13-25-20(23)16-7-9-17(10-8-16)21-11-3-6-19(21)22/h2,4-5,7-10,14H,3,6,11-13H2,1H3 |
| InChIKey | HJUFAMOZAICCJO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|