C10H19N5O3 — CID 74049177
ethyl 4-(3-oxo-1,2,4-triazinan-5-yl)piperazine-1-carboxylate (PubChem CID 74049177) has the molecular formula C10H19N5O3 and a molecular weight of 257.29 g/mol. Its IUPAC name is ethyl 4-(3-oxo-1,2,4-triazinan-5-yl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(3-oxo-1,2,4-triazinan-5-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 74049177 |
| Molecular Formula | C10H19N5O3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | ethyl 4-(3-oxo-1,2,4-triazinan-5-yl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C2CNNC(=O)N2)CC1 |
| InChI | InChI=1S/C10H19N5O3/c1-2-18-10(17)15-5-3-14(4-6-15)8-7-11-13-9(16)12-8/h8,11H,2-7H2,1H3,(H2,12,13,16) |
| InChIKey | WVHLHPRQHMKFIP-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |