C14H23N3O3 — CID 98157899
ethyl 4-[(1S,2R,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperazine-1-carboxylate (PubChem CID 98157899) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is ethyl 4-[(1S,2R,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(1S,2R,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 98157899 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | ethyl 4-[(1S,2R,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN([C@H]2/C(=N\O)[C@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C14H23N3O3/c1-2-20-14(18)17-7-5-16(6-8-17)13-11-4-3-10(9-11)12(13)15-19/h10-11,13,19H,2-9H2,1H3/b15-12-/t10-,11-,13+/m0/s1 |
| InChIKey | ALCHYENEIWGTJQ-DGNDVIFTSA-N |
| XLogP | 1.39 |
| TPSA | 65.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|