About 1,3-dimethyl-6-propan-2-yl-2-oxatricyclo[5.3.1.03,8]undecane
1,3-dimethyl-6-propan-2-yl-2-oxatricyclo[5.3.1.03,8]undecane (PubChem CID 74051960) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is 1,3-dimethyl-6-propan-2-yl-2-oxatricyclo[5.3.1.03,8]undecane.
Analyze 1,3-dimethyl-6-propan-2-yl-2-oxatricyclo[5.3.1.03,8]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-6-propan-2-yl-2-oxatricyclo[5.3.1.03,8]undecane?
The IUPAC name of 1,3-dimethyl-6-propan-2-yl-2-oxatricyclo[5.3.1.03,8]undecane (CID 74051960) is 1,3-dimethyl-6-propan-2-yl-2-oxatricyclo[5.3.1.03,8]undecane.
What is the SMILES notation for 1,3-dimethyl-6-propan-2-yl-2-oxatricyclo[5.3.1.03,8]undecane?
The canonical SMILES for 1,3-dimethyl-6-propan-2-yl-2-oxatricyclo[5.3.1.03,8]undecane is CC(C)C1CCC2(C)OC3(C)CCC2C1C3.
What is the InChIKey of 1,3-dimethyl-6-propan-2-yl-2-oxatricyclo[5.3.1.03,8]undecane?
The InChIKey is GRFWMFZRMJAPKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O/c1-10(2)11-5-8-15(4)13-6-7-14(3,16-15)9-12(11)13/h10-13H,5-9H2,1-4H3.
What are the key properties of 1,3-dimethyl-6-propan-2-yl-2-oxatricyclo[5.3.1.03,8]undecane?
1,3-dimethyl-6-propan-2-yl-2-oxatricyclo[5.3.1.03,8]undecane has a molecular weight of 222.37 g/mol, XLogP of 4.02, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-6-propan-2-yl-2-oxatricyclo[5.3.1.03,8]undecane is sourced from PubChem (CID 74051960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).