C17H19ClN2O4S — CID 7405528
methyl 2-[[[(2R)-2-chloro-2-phenylacetyl]-(2-methoxyethyl)amino]methyl]-1,3-thiazole-4-carboxylate (PubChem CID 7405528) has the molecular formula C17H19ClN2O4S and a molecular weight of 382.87 g/mol. Its IUPAC name is methyl 2-[[[(2R)-2-chloro-2-phenylacetyl]-(2-methoxyethyl)amino]methyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[[(2R)-2-chloro-2-phenylacetyl]-(2-methoxyethyl)amino]methyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 7405528 |
| Molecular Formula | C17H19ClN2O4S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | methyl 2-[[[(2R)-2-chloro-2-phenylacetyl]-(2-methoxyethyl)amino]methyl]-1,3-thiazole-4-carboxylate |
| SMILES | COCCN(Cc1nc(C(=O)OC)cs1)C(=O)[C@H](Cl)c1ccccc1 |
| InChI | InChI=1S/C17H19ClN2O4S/c1-23-9-8-20(10-14-19-13(11-25-14)17(22)24-2)16(21)15(18)12-6-4-3-5-7-12/h3-7,11,15H,8-10H2,1-2H3/t15-/m1/s1 |
| InChIKey | NIVWYRSFHVNISJ-OAHLLOKOSA-N |
| XLogP | 2.88 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|