C22H23FN2O8 — CID 74060232
diethyl 1-benzyl-4-(2-ethoxy-1-nitro-2-oxoethylidene)-3-fluoropyridine-2,6-dicarboxylate (PubChem CID 74060232) has the molecular formula C22H23FN2O8 and a molecular weight of 462.43 g/mol. Its IUPAC name is diethyl 1-benzyl-4-(2-ethoxy-1-nitro-2-oxoethylidene)-3-fluoropyridine-2,6-dicarboxylate.
| Compound Name | diethyl 1-benzyl-4-(2-ethoxy-1-nitro-2-oxoethylidene)-3-fluoropyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 74060232 |
| Molecular Formula | C22H23FN2O8 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | diethyl 1-benzyl-4-(2-ethoxy-1-nitro-2-oxoethylidene)-3-fluoropyridine-2,6-dicarboxylate |
| SMILES | CCOC(=O)C1=CC(=C(C(=O)OCC)[N+](=O)[O-])C(F)=C(C(=O)OCC)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H23FN2O8/c1-4-31-20(26)16-12-15(18(25(29)30)21(27)32-5-2)17(23)19(22(28)33-6-3)24(16)13-14-10-8-7-9-11-14/h7-12H,4-6,13H2,1-3H3 |
| InChIKey | UUDUYTLCCHDEBK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|