C15H18N2O4 — CID 10935153
methyl (Z)-2-nitro-3-phenyl-3-piperidin-1-ylprop-2-enoate (PubChem CID 10935153) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl (Z)-2-nitro-3-phenyl-3-piperidin-1-ylprop-2-enoate.
| Compound Name | methyl (Z)-2-nitro-3-phenyl-3-piperidin-1-ylprop-2-enoate |
|---|---|
| PubChem CID | 10935153 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl (Z)-2-nitro-3-phenyl-3-piperidin-1-ylprop-2-enoate |
| SMILES | COC(=O)/C(=C(\c1ccccc1)N1CCCCC1)[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N2O4/c1-21-15(18)14(17(19)20)13(12-8-4-2-5-9-12)16-10-6-3-7-11-16/h2,4-5,8-9H,3,6-7,10-11H2,1H3/b14-13- |
| InChIKey | RMIGGNGNCLCPGV-YPKPFQOOSA-N |
| XLogP | 2.29 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|