C18H24N2O4 — CID 5368197
ethyl (2E)-2-[1-benzyl-6-methyl-4-(nitromethyl)piperidin-2-ylidene]acetate (PubChem CID 5368197) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is ethyl (2E)-2-[1-benzyl-6-methyl-4-(nitromethyl)piperidin-2-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[1-benzyl-6-methyl-4-(nitromethyl)piperidin-2-ylidene]acetate |
|---|---|
| PubChem CID | 5368197 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | ethyl (2E)-2-[1-benzyl-6-methyl-4-(nitromethyl)piperidin-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CC(C[N+](=O)[O-])CC(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H24N2O4/c1-3-24-18(21)11-17-10-16(13-20(22)23)9-14(2)19(17)12-15-7-5-4-6-8-15/h4-8,11,14,16H,3,9-10,12-13H2,1-2H3/b17-11+ |
| InChIKey | PEQBMQLCDDGTHV-GZTJUZNOSA-N |
| XLogP | 3.01 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|