C19H23N3O2S — CID 74068913
3-(3-methoxyphenyl)-5-propyl-4-thiophen-2-yl-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one (PubChem CID 74068913) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-5-propyl-4-thiophen-2-yl-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one.
| Compound Name | 3-(3-methoxyphenyl)-5-propyl-4-thiophen-2-yl-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one |
|---|---|
| PubChem CID | 74068913 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 3-(3-methoxyphenyl)-5-propyl-4-thiophen-2-yl-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one |
| SMILES | CCCN1C(=O)C2NNC(c3cccc(OC)c3)C2C1c1cccs1 |
| InChI | InChI=1S/C19H23N3O2S/c1-3-9-22-18(14-8-5-10-25-14)15-16(20-21-17(15)19(22)23)12-6-4-7-13(11-12)24-2/h4-8,10-11,15-18,20-21H,3,9H2,1-2H3 |
| InChIKey | PITGETPTOKQVNB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |