1-methylthionin-1-ium chloride

C9H11ClS — CID 74069729

IUPAC1-methylthionin-1-ium chloride
SMILESC[s+]1cccccccc1.[Cl-]
InChIInChI=1S/C9H11S.ClH/c1-10-8-6-4-2-3-5-7-9-10;/h2-9H,1H3;1H/q+1;/p-1
InChIKeyCOIGXQNVLVFUJE-UHFFFAOYSA-M
MW186.71 g/mol
LogP0.10
Rot. Bonds

About 1-methylthionin-1-ium chloride

1-methylthionin-1-ium chloride (PubChem CID 74069729) has the molecular formula C9H11ClS and a molecular weight of 186.71 g/mol. Its IUPAC name is 1-methylthionin-1-ium chloride.

Molecular Properties

Compound Name1-methylthionin-1-ium chloride
PubChem CID74069729
Molecular FormulaC9H11ClS
Molecular Weight186.71 g/mol
Exact Mass186.03
IUPAC Name1-methylthionin-1-ium chloride
SMILESC[s+]1cccccccc1.[Cl-]
InChIInChI=1S/C9H11S.ClH/c1-10-8-6-4-2-3-5-7-9-10;/h2-9H,1H3;1H/q+1;/p-1
InChIKeyCOIGXQNVLVFUJE-UHFFFAOYSA-M
XLogP0.10
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.71
LogP ≤ 50.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}

Analyze 1-methylthionin-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methylthionin-1-ium chloride?
The IUPAC name of 1-methylthionin-1-ium chloride (CID 74069729) is 1-methylthionin-1-ium chloride.
What is the SMILES notation for 1-methylthionin-1-ium chloride?
The canonical SMILES for 1-methylthionin-1-ium chloride is C[s+]1cccccccc1.[Cl-].
What is the InChIKey of 1-methylthionin-1-ium chloride?
The InChIKey is COIGXQNVLVFUJE-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H11S.ClH/c1-10-8-6-4-2-3-5-7-9-10;/h2-9H,1H3;1H/q+1;/p-1.
What are the key properties of 1-methylthionin-1-ium chloride?
1-methylthionin-1-ium chloride has a molecular weight of 186.71 g/mol, XLogP of 0.10, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylthionin-1-ium chloride is sourced from PubChem (CID 74069729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).