C8H11FS — CID 142097950
(1E,3Z,5E)-5-fluoro-1-methylsulfanylhepta-1,3,5-triene (PubChem CID 142097950) has the molecular formula C8H11FS and a molecular weight of 158.24 g/mol. Its IUPAC name is (1E,3Z,5E)-5-fluoro-1-methylsulfanylhepta-1,3,5-triene.
| Compound Name | (1E,3Z,5E)-5-fluoro-1-methylsulfanylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 142097950 |
| Molecular Formula | C8H11FS |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | (1E,3Z,5E)-5-fluoro-1-methylsulfanylhepta-1,3,5-triene |
| SMILES | C/C=C(F)\C=C/C=C/SC |
| InChI | InChI=1S/C8H11FS/c1-3-8(9)6-4-5-7-10-2/h3-7H,1-2H3/b6-4-,7-5+,8-3+ |
| InChIKey | MPTZATOTCCWOSX-LYURDHKTSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|