C10H13FS — CID 135231187
(3E)-4-fluoro-2-[(2E)-penta-2,4-dien-2-yl]sulfanylpenta-1,3-diene (PubChem CID 135231187) has the molecular formula C10H13FS and a molecular weight of 184.28 g/mol. Its IUPAC name is (3E)-4-fluoro-2-[(2E)-penta-2,4-dien-2-yl]sulfanylpenta-1,3-diene.
| Compound Name | (3E)-4-fluoro-2-[(2E)-penta-2,4-dien-2-yl]sulfanylpenta-1,3-diene |
|---|---|
| PubChem CID | 135231187 |
| Molecular Formula | C10H13FS |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (3E)-4-fluoro-2-[(2E)-penta-2,4-dien-2-yl]sulfanylpenta-1,3-diene |
| SMILES | C=C/C=C(\C)SC(=C)/C=C(\C)F |
| InChI | InChI=1S/C10H13FS/c1-5-6-9(3)12-10(4)7-8(2)11/h5-7H,1,4H2,2-3H3/b8-7+,9-6+ |
| InChIKey | RQMIRQVUOJVDDG-KHHFIZIMSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|