C31H38O12 — CID 74070576
2-(22-acetyloxy-4-hydroxy-4,9,11,19,19-pentamethyl-5,10,24-trioxo-2,6,18,25-tetraoxaheptacyclo[12.10.1.11,8.03,7.014,23.016,20.011,26]hexacos-16(20)-en-17-yl)acetic acid (PubChem CID 74070576) has the molecular formula C31H38O12 and a molecular weight of 602.63 g/mol. Its IUPAC name is 2-(22-acetyloxy-4-hydroxy-4,9,11,19,19-pentamethyl-5,10,24-trioxo-2,6,18,25-tetraoxaheptacyclo[12.10.1.11,8.03,7.014,23.016,20.011,26]hexacos-16(20)-en-17-yl)acetic acid.
| Compound Name | 2-(22-acetyloxy-4-hydroxy-4,9,11,19,19-pentamethyl-5,10,24-trioxo-2,6,18,25-tetraoxaheptacyclo[12.10.1.11,8.03,7.014,23.016,20.011,26]hexacos-16(20)-en-17-yl)acetic acid |
|---|---|
| PubChem CID | 74070576 |
| Molecular Formula | C31H38O12 |
| Molecular Weight | 602.63 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | 2-(22-acetyloxy-4-hydroxy-4,9,11,19,19-pentamethyl-5,10,24-trioxo-2,6,18,25-tetraoxaheptacyclo[12.10.1.11,8.03,7.014,23.016,20.011,26]hexacos-16(20)-en-17-yl)acetic acid |
| SMILES | CC(=O)OC1CC2=C(CC34CCC5(C)C(=O)C(C)C6C7OC(=O)C(C)(O)C7OC(O3)(C(=O)C14)C65)C(CC(=O)O)OC2(C)C |
| InChI | InChI=1S/C31H38O12/c1-12-19-21-25(29(6,38)26(37)40-21)42-31-22(19)28(5,23(12)35)7-8-30(43-31)11-14-15(27(3,4)41-16(14)10-18(33)34)9-17(39-13(2)32)20(30)24(31)36/h12,16-17,19-22,25,38H,7-11H2,1-6H3,(H,33,34) |
| InChIKey | GQSDVFBROOVBAH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 171.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.63 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|