C23H29ClN4O2+2 — CID 7407815
2-[4-[(2-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]-N-[(Z)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]acetamide (PubChem CID 7407815) has the molecular formula C23H29ClN4O2+2 and a molecular weight of 428.96 g/mol. Its IUPAC name is 2-[4-[(2-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]-N-[(Z)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]acetamide.
| Compound Name | 2-[4-[(2-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]-N-[(Z)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]acetamide |
|---|---|
| PubChem CID | 7407815 |
| Molecular Formula | C23H29ClN4O2+2 |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-[4-[(2-chlorophenyl)methyl]piperazine-1,4-diium-1-yl]-N-[(Z)-[(E)-3-(2-methoxyphenyl)prop-2-enylidene]amino]acetamide |
| SMILES | COc1ccccc1/C=C/C=N\NC(=O)C[NH+]1CC[NH+](Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C23H27ClN4O2/c1-30-22-11-5-3-7-19(22)9-6-12-25-26-23(29)18-28-15-13-27(14-16-28)17-20-8-2-4-10-21(20)24/h2-12H,13-18H2,1H3,(H,26,29)/p+2/b9-6+,25-12- |
| InChIKey | WEYIRIOKMYHINH-WKNZXEKLSA-P |
| XLogP | 0.45 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|