About ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate
ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate (PubChem CID 740873) has the molecular formula C16H18N2O4S
and a molecular weight of 334.40 g/mol. Its IUPAC name is ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate |
| PubChem CID | 740873 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1sc2nc(C)cc(C)c2c1N(C(C)=O)C(C)=O |
| InChI | InChI=1S/C16H18N2O4S/c1-6-22-16(21)14-13(18(10(4)19)11(5)20)12-8(2)7-9(3)17-15(12)23-14/h7H,6H2,1-5H3 |
| InChIKey | PNIUZDCLLFELHY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate?
The IUPAC name of ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate (CID 740873) is ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate.
What is the SMILES notation for ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate?
The canonical SMILES for ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate is CCOC(=O)c1sc2nc(C)cc(C)c2c1N(C(C)=O)C(C)=O.
What is the InChIKey of ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate?
The InChIKey is PNIUZDCLLFELHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O4S/c1-6-22-16(21)14-13(18(10(4)19)11(5)20)12-8(2)7-9(3)17-15(12)23-14/h7H,6H2,1-5H3.
What are the key properties of ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate?
ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate has a molecular weight of 334.40 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(diacetylamino)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxylate is sourced from PubChem (CID 740873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).