C16H20NO3- — CID 7410816
(1R,2R,3S)-1,2-dimethyl-3-(phenylcarbamoyl)cyclohexane-1-carboxylate (PubChem CID 7410816) has the molecular formula C16H20NO3- and a molecular weight of 274.34 g/mol. Its IUPAC name is (1R,2R,3S)-1,2-dimethyl-3-(phenylcarbamoyl)cyclohexane-1-carboxylate.
| Compound Name | (1R,2R,3S)-1,2-dimethyl-3-(phenylcarbamoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 7410816 |
| Molecular Formula | C16H20NO3- |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (1R,2R,3S)-1,2-dimethyl-3-(phenylcarbamoyl)cyclohexane-1-carboxylate |
| SMILES | C[C@@H]1[C@@H](C(=O)Nc2ccccc2)CCC[C@@]1(C)C(=O)[O-] |
| InChI | InChI=1S/C16H21NO3/c1-11-13(9-6-10-16(11,2)15(19)20)14(18)17-12-7-4-3-5-8-12/h3-5,7-8,11,13H,6,9-10H2,1-2H3,(H,17,18)(H,19,20)/p-1/t11-,13+,16-/m1/s1 |
| InChIKey | GYKACBKRAJXZDQ-PVXIVEMSSA-M |
| XLogP | 1.82 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |