About propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate
propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate (PubChem CID 7418681) has the molecular formula C15H22N2O2S
and a molecular weight of 294.42 g/mol. Its IUPAC name is propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate.
Molecular Properties
| Compound Name | propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate |
| PubChem CID | 7418681 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate |
| SMILES | CC1CCN(/C(=N/C(=O)c2cccs2)OC(C)C)CC1 |
| InChI | InChI=1S/C15H22N2O2S/c1-11(2)19-15(17-8-6-12(3)7-9-17)16-14(18)13-5-4-10-20-13/h4-5,10-12H,6-9H2,1-3H3/b16-15- |
| InChIKey | JRVHMORXPMMQIR-NXVVXOECSA-N |
| XLogP | 3.40 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate?
The IUPAC name of propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate (CID 7418681) is propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate.
What is the SMILES notation for propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate?
The canonical SMILES for propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate is CC1CCN(/C(=N/C(=O)c2cccs2)OC(C)C)CC1.
What is the InChIKey of propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate?
The InChIKey is JRVHMORXPMMQIR-NXVVXOECSA-N. The full InChI is InChI=1S/C15H22N2O2S/c1-11(2)19-15(17-8-6-12(3)7-9-17)16-14(18)13-5-4-10-20-13/h4-5,10-12H,6-9H2,1-3H3/b16-15-.
What are the key properties of propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate?
propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate has a molecular weight of 294.42 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 4-methyl-N-(thiophene-2-carbonyl)piperidine-1-carboximidate is sourced from PubChem (CID 7418681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).