C21H27N2O2+ — CID 7419139
(4-methoxyphenyl)methyl-[(2S)-1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl]azanium (PubChem CID 7419139) has the molecular formula C21H27N2O2+ and a molecular weight of 339.46 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl-[(2S)-1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl]azanium.
| Compound Name | (4-methoxyphenyl)methyl-[(2S)-1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 7419139 |
| Molecular Formula | C21H27N2O2+ |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | (4-methoxyphenyl)methyl-[(2S)-1-oxo-3-phenyl-1-pyrrolidin-1-ylpropan-2-yl]azanium |
| SMILES | COc1ccc(C[NH2+][C@@H](Cc2ccccc2)C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H26N2O2/c1-25-19-11-9-18(10-12-19)16-22-20(15-17-7-3-2-4-8-17)21(24)23-13-5-6-14-23/h2-4,7-12,20,22H,5-6,13-16H2,1H3/p+1/t20-/m0/s1 |
| InChIKey | NXWDRCSAJKTXSY-FQEVSTJZSA-O |
| XLogP | 1.99 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |