C27H46O5 — CID 74218550
2-[3-(1,3-dihydroxy-6-methylheptan-2-yl)-2-(2-hydroxyethyl)-2-methylcyclopentyl]-6-hydroxy-8a-methyl-2,3,5,6,7,8-hexahydronaphthalen-1-one (PubChem CID 74218550) has the molecular formula C27H46O5 and a molecular weight of 450.66 g/mol. Its IUPAC name is 2-[3-(1,3-dihydroxy-6-methylheptan-2-yl)-2-(2-hydroxyethyl)-2-methylcyclopentyl]-6-hydroxy-8a-methyl-2,3,5,6,7,8-hexahydronaphthalen-1-one.
| Compound Name | 2-[3-(1,3-dihydroxy-6-methylheptan-2-yl)-2-(2-hydroxyethyl)-2-methylcyclopentyl]-6-hydroxy-8a-methyl-2,3,5,6,7,8-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 74218550 |
| Molecular Formula | C27H46O5 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | 2-[3-(1,3-dihydroxy-6-methylheptan-2-yl)-2-(2-hydroxyethyl)-2-methylcyclopentyl]-6-hydroxy-8a-methyl-2,3,5,6,7,8-hexahydronaphthalen-1-one |
| SMILES | CC(C)CCC(O)C(CO)C1CCC(C2CC=C3CC(O)CCC3(C)C2=O)C1(C)CCO |
| InChI | InChI=1S/C27H46O5/c1-17(2)5-10-24(31)21(16-29)23-9-8-22(27(23,4)13-14-28)20-7-6-18-15-19(30)11-12-26(18,3)25(20)32/h6,17,19-24,28-31H,5,7-16H2,1-4H3 |
| InChIKey | UBOJZZZMRJVCSD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|