C20H28O7 — CID 74218926
[10-(hydroxymethyl)-3,6-dimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-4-yl] 3,4-dihydroxy-2-methylidenebutanoate (PubChem CID 74218926) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is [10-(hydroxymethyl)-3,6-dimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-4-yl] 3,4-dihydroxy-2-methylidenebutanoate.
| Compound Name | [10-(hydroxymethyl)-3,6-dimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-4-yl] 3,4-dihydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 74218926 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [10-(hydroxymethyl)-3,6-dimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-4-yl] 3,4-dihydroxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OC1CC(C)=CCCC(CO)=CC2OC(=O)C(C)C21)C(O)CO |
| InChI | InChI=1S/C20H28O7/c1-11-5-4-6-14(9-21)8-17-18(13(3)20(25)27-17)16(7-11)26-19(24)12(2)15(23)10-22/h5,8,13,15-18,21-23H,2,4,6-7,9-10H2,1,3H3 |
| InChIKey | IEIQVTKGRCQFFO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|