C20H30O5 — CID 163103706
[10-(hydroxymethyl)-3,6-dimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-4-yl] 3-methylbutanoate (PubChem CID 163103706) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is [10-(hydroxymethyl)-3,6-dimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-4-yl] 3-methylbutanoate.
| Compound Name | [10-(hydroxymethyl)-3,6-dimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-4-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 163103706 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | [10-(hydroxymethyl)-3,6-dimethyl-2-oxo-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-4-yl] 3-methylbutanoate |
| SMILES | CC1=CCCC(CO)=CC2OC(=O)C(C)C2C(OC(=O)CC(C)C)C1 |
| InChI | InChI=1S/C20H30O5/c1-12(2)8-18(22)24-16-9-13(3)6-5-7-15(11-21)10-17-19(16)14(4)20(23)25-17/h6,10,12,14,16-17,19,21H,5,7-9,11H2,1-4H3 |
| InChIKey | CORPOBIVEWKOMG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|