C18H20FNO3S — CID 74221851
3-[3-fluoro-4-[(6-propan-2-ylsulfanyl-2-pyridinyl)methoxy]phenyl]propanoic acid (PubChem CID 74221851) has the molecular formula C18H20FNO3S and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-[3-fluoro-4-[(6-propan-2-ylsulfanyl-2-pyridinyl)methoxy]phenyl]propanoic acid.
| Compound Name | 3-[3-fluoro-4-[(6-propan-2-ylsulfanyl-2-pyridinyl)methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 74221851 |
| Molecular Formula | C18H20FNO3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 3-[3-fluoro-4-[(6-propan-2-ylsulfanyl-2-pyridinyl)methoxy]phenyl]propanoic acid |
| SMILES | CC(C)Sc1cccc(COc2ccc(CCC(=O)O)cc2F)n1 |
| InChI | InChI=1S/C18H20FNO3S/c1-12(2)24-17-5-3-4-14(20-17)11-23-16-8-6-13(10-15(16)19)7-9-18(21)22/h3-6,8,10,12H,7,9,11H2,1-2H3,(H,21,22) |
| InChIKey | GUCWFXLCDUWXGL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |