C19H20ClNO3S — CID 90118275
3-[3-chloro-4-[[6-(cyclopropylmethylsulfanyl)-2-pyridinyl]methoxy]phenyl]propanoic acid (PubChem CID 90118275) has the molecular formula C19H20ClNO3S and a molecular weight of 377.89 g/mol. Its IUPAC name is 3-[3-chloro-4-[[6-(cyclopropylmethylsulfanyl)-2-pyridinyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[3-chloro-4-[[6-(cyclopropylmethylsulfanyl)-2-pyridinyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 90118275 |
| Molecular Formula | C19H20ClNO3S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 3-[3-chloro-4-[[6-(cyclopropylmethylsulfanyl)-2-pyridinyl]methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCc2cccc(SCC3CC3)n2)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClNO3S/c20-16-10-13(7-9-19(22)23)6-8-17(16)24-11-15-2-1-3-18(21-15)25-12-14-4-5-14/h1-3,6,8,10,14H,4-5,7,9,11-12H2,(H,22,23) |
| InChIKey | BXOCWSNPSXZWBU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |